C39H38N2O4 — CID 70962976
2-[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]-4-[[(4-methylphenyl)-diphenylmethyl]amino]butanoic acid (PubChem CID 70962976) has the molecular formula C39H38N2O4 and a molecular weight of 598.74 g/mol. Its IUPAC name is 2-[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]-4-[[(4-methylphenyl)-diphenylmethyl]amino]butanoic acid.
| Compound Name | 2-[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]-4-[[(4-methylphenyl)-diphenylmethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 70962976 |
| Molecular Formula | C39H38N2O4 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 2-[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]-4-[[(4-methylphenyl)-diphenylmethyl]amino]butanoic acid |
| SMILES | Cc1ccc(C(NCCC(NC(O)OCC2c3ccccc3-c3ccccc32)C(=O)O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H38N2O4/c1-27-20-22-30(23-21-27)39(28-12-4-2-5-13-28,29-14-6-3-7-15-29)40-25-24-36(37(42)43)41-38(44)45-26-35-33-18-10-8-16-31(33)32-17-9-11-19-34(32)35/h2-23,35-36,38,40-41,44H,24-26H2,1H3,(H,42,43) |
| InChIKey | IEWKYOLNQJBWMY-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|