C35H46N2O7 — CID 51340441
4-[3-[2-[2-[3-[[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethyl]amino]propoxy]ethoxy]ethoxy]propylamino]-4-oxobutanoic acid (PubChem CID 51340441) has the molecular formula C35H46N2O7 and a molecular weight of 606.76 g/mol. Its IUPAC name is 4-[3-[2-[2-[3-[[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethyl]amino]propoxy]ethoxy]ethoxy]propylamino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[2-[2-[3-[[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethyl]amino]propoxy]ethoxy]ethoxy]propylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 51340441 |
| Molecular Formula | C35H46N2O7 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.33 |
| IUPAC Name | 4-[3-[2-[2-[3-[[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethyl]amino]propoxy]ethoxy]ethoxy]propylamino]-4-oxobutanoic acid |
| SMILES | COc1ccc(C(NCCCOCCOCCOCCCNC(=O)CCC(=O)O)(c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C35H46N2O7/c1-28-10-12-30(13-11-28)35(29-8-4-3-5-9-29,31-14-16-32(41-2)17-15-31)37-21-7-23-43-25-27-44-26-24-42-22-6-20-36-33(38)18-19-34(39)40/h3-5,8-17,37H,6-7,18-27H2,1-2H3,(H,36,38)(H,39,40) |
| InChIKey | BHWPRSLJNVQWDF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|