C38H48N2O2Si — CID 175739031
N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanamide (PubChem CID 175739031) has the molecular formula C38H48N2O2Si and a molecular weight of 592.90 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanamide.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanamide |
|---|---|
| PubChem CID | 175739031 |
| Molecular Formula | C38H48N2O2Si |
| Molecular Weight | 592.90 g/mol |
| Exact Mass | 592.35 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanamide |
| SMILES | Cc1ccc(C(NCCCCCC(=O)Nc2ccc(O[Si](C)(C)C(C)(C)C)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H48N2O2Si/c1-30-21-23-33(24-22-30)38(31-16-10-7-11-17-31,32-18-12-8-13-19-32)39-29-15-9-14-20-36(41)40-34-25-27-35(28-26-34)42-43(5,6)37(2,3)4/h7-8,10-13,16-19,21-28,39H,9,14-15,20,29H2,1-6H3,(H,40,41) |
| InChIKey | VISBVZJVLJEKND-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.90 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|