C26H27NO4 — CID 4178212
5-oxo-5-[4-[4-(2-phenylpropan-2-yl)phenoxy]anilino]pentanoic acid (PubChem CID 4178212) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is 5-oxo-5-[4-[4-(2-phenylpropan-2-yl)phenoxy]anilino]pentanoic acid.
| Compound Name | 5-oxo-5-[4-[4-(2-phenylpropan-2-yl)phenoxy]anilino]pentanoic acid |
|---|---|
| PubChem CID | 4178212 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 5-oxo-5-[4-[4-(2-phenylpropan-2-yl)phenoxy]anilino]pentanoic acid |
| SMILES | CC(C)(c1ccccc1)c1ccc(Oc2ccc(NC(=O)CCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H27NO4/c1-26(2,19-7-4-3-5-8-19)20-11-15-22(16-12-20)31-23-17-13-21(14-18-23)27-24(28)9-6-10-25(29)30/h3-5,7-8,11-18H,6,9-10H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | BWKQQUYUTDRMGF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |