C33H30N2O7 — CID 3430720
[2-(4-nitrophenyl)-2-oxoethyl] 4-oxo-4-[4-[4-(2-phenylpropan-2-yl)phenoxy]anilino]butanoate (PubChem CID 3430720) has the molecular formula C33H30N2O7 and a molecular weight of 566.61 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 4-oxo-4-[4-[4-(2-phenylpropan-2-yl)phenoxy]anilino]butanoate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 4-oxo-4-[4-[4-(2-phenylpropan-2-yl)phenoxy]anilino]butanoate |
|---|---|
| PubChem CID | 3430720 |
| Molecular Formula | C33H30N2O7 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 4-oxo-4-[4-[4-(2-phenylpropan-2-yl)phenoxy]anilino]butanoate |
| SMILES | CC(C)(c1ccccc1)c1ccc(Oc2ccc(NC(=O)CCC(=O)OCC(=O)c3ccc([N+](=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C33H30N2O7/c1-33(2,24-6-4-3-5-7-24)25-10-16-28(17-11-25)42-29-18-12-26(13-19-29)34-31(37)20-21-32(38)41-22-30(36)23-8-14-27(15-9-23)35(39)40/h3-19H,20-22H2,1-2H3,(H,34,37) |
| InChIKey | NUZCOHWPCXOEGK-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|