C24H18Cl2N2O7 — CID 3543719
[2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 4-(3,4-dichloroanilino)-4-oxobutanoate (PubChem CID 3543719) has the molecular formula C24H18Cl2N2O7 and a molecular weight of 517.32 g/mol. Its IUPAC name is [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 4-(3,4-dichloroanilino)-4-oxobutanoate.
| Compound Name | [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 4-(3,4-dichloroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 3543719 |
| Molecular Formula | C24H18Cl2N2O7 |
| Molecular Weight | 517.32 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 4-(3,4-dichloroanilino)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCC(=O)c1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H18Cl2N2O7/c25-20-10-3-16(13-21(20)26)27-23(30)11-12-24(31)34-14-22(29)15-1-6-18(7-2-15)35-19-8-4-17(5-9-19)28(32)33/h1-10,13H,11-12,14H2,(H,27,30) |
| InChIKey | GHVWRKLYFGBLKJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.32 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|