C18H14Cl2N2O6 — CID 32712005
[2-(3,4-dichlorophenyl)-2-oxoethyl] 3-[(4-nitrobenzoyl)amino]propanoate (PubChem CID 32712005) has the molecular formula C18H14Cl2N2O6 and a molecular weight of 425.22 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 3-[(4-nitrobenzoyl)amino]propanoate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 3-[(4-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 32712005 |
| Molecular Formula | C18H14Cl2N2O6 |
| Molecular Weight | 425.22 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 3-[(4-nitrobenzoyl)amino]propanoate |
| SMILES | O=C(CCNC(=O)c1ccc([N+](=O)[O-])cc1)OCC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2N2O6/c19-14-6-3-12(9-15(14)20)16(23)10-28-17(24)7-8-21-18(25)11-1-4-13(5-2-11)22(26)27/h1-6,9H,7-8,10H2,(H,21,25) |
| InChIKey | FNRJTGZSBQGCRX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|