C20H21N3O6 — CID 29200938
[2-oxo-2-(2-phenylethylamino)ethyl] 3-[(4-nitrobenzoyl)amino]propanoate (PubChem CID 29200938) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylethylamino)ethyl] 3-[(4-nitrobenzoyl)amino]propanoate.
| Compound Name | [2-oxo-2-(2-phenylethylamino)ethyl] 3-[(4-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 29200938 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | [2-oxo-2-(2-phenylethylamino)ethyl] 3-[(4-nitrobenzoyl)amino]propanoate |
| SMILES | O=C(COC(=O)CCNC(=O)c1ccc([N+](=O)[O-])cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C20H21N3O6/c24-18(21-12-10-15-4-2-1-3-5-15)14-29-19(25)11-13-22-20(26)16-6-8-17(9-7-16)23(27)28/h1-9H,10-14H2,(H,21,24)(H,22,26) |
| InChIKey | HKYVXLCAEHTBGO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|