C20H20F3N3O6 — CID 4858518
[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl] 3-[(4-nitrobenzoyl)amino]propanoate (PubChem CID 4858518) has the molecular formula C20H20F3N3O6 and a molecular weight of 455.39 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl] 3-[(4-nitrobenzoyl)amino]propanoate.
| Compound Name | [2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl] 3-[(4-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 4858518 |
| Molecular Formula | C20H20F3N3O6 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | [2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl] 3-[(4-nitrobenzoyl)amino]propanoate |
| SMILES | Cc1cc(C(=O)COC(=O)CCNC(=O)c2ccc([N+](=O)[O-])cc2)c(C)n1CC(F)(F)F |
| InChI | InChI=1S/C20H20F3N3O6/c1-12-9-16(13(2)25(12)11-20(21,22)23)17(27)10-32-18(28)7-8-24-19(29)14-3-5-15(6-4-14)26(30)31/h3-6,9H,7-8,10-11H2,1-2H3,(H,24,29) |
| InChIKey | JZGZGTNFMODTIC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|