C22H27ClN2O4 — CID 42973095
[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate (PubChem CID 42973095) has the molecular formula C22H27ClN2O4 and a molecular weight of 418.92 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate.
| Compound Name | [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 42973095 |
| Molecular Formula | C22H27ClN2O4 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
| SMILES | CCCn1c(C)cc(C(=O)COC(=O)CCCNC(=O)c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C22H27ClN2O4/c1-4-12-25-15(2)13-19(16(25)3)20(26)14-29-21(27)6-5-11-24-22(28)17-7-9-18(23)10-8-17/h7-10,13H,4-6,11-12,14H2,1-3H3,(H,24,28) |
| InChIKey | WARHGUZCIDIONF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|