C19H24N2O4S — CID 30406194
[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 4-(thiophene-3-carbonylamino)butanoate (PubChem CID 30406194) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is [2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 4-(thiophene-3-carbonylamino)butanoate.
| Compound Name | [2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 4-(thiophene-3-carbonylamino)butanoate |
|---|---|
| PubChem CID | 30406194 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 4-(thiophene-3-carbonylamino)butanoate |
| SMILES | CCn1c(C)cc(C(=O)COC(=O)CCCNC(=O)c2ccsc2)c1C |
| InChI | InChI=1S/C19H24N2O4S/c1-4-21-13(2)10-16(14(21)3)17(22)11-25-18(23)6-5-8-20-19(24)15-7-9-26-12-15/h7,9-10,12H,4-6,8,11H2,1-3H3,(H,20,24) |
| InChIKey | TXZMXXAQUUACCB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|