C16H15F2NO3S — CID 166217693
(2,4-difluorophenyl)methyl 4-(thiophene-3-carbonylamino)butanoate (PubChem CID 166217693) has the molecular formula C16H15F2NO3S and a molecular weight of 339.36 g/mol. Its IUPAC name is (2,4-difluorophenyl)methyl 4-(thiophene-3-carbonylamino)butanoate.
| Compound Name | (2,4-difluorophenyl)methyl 4-(thiophene-3-carbonylamino)butanoate |
|---|---|
| PubChem CID | 166217693 |
| Molecular Formula | C16H15F2NO3S |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | (2,4-difluorophenyl)methyl 4-(thiophene-3-carbonylamino)butanoate |
| SMILES | O=C(CCCNC(=O)c1ccsc1)OCc1ccc(F)cc1F |
| InChI | InChI=1S/C16H15F2NO3S/c17-13-4-3-11(14(18)8-13)9-22-15(20)2-1-6-19-16(21)12-5-7-23-10-12/h3-5,7-8,10H,1-2,6,9H2,(H,19,21) |
| InChIKey | DQQBNXNBFVRCGV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|