C17H19NO4S — CID 46816863
(2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate (PubChem CID 46816863) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate.
| Compound Name | (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 46816863 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate |
| SMILES | CCOc1ccccc1COC(=O)CCNC(=O)c1ccsc1 |
| InChI | InChI=1S/C17H19NO4S/c1-2-21-15-6-4-3-5-13(15)11-22-16(19)7-9-18-17(20)14-8-10-23-12-14/h3-6,8,10,12H,2,7,9,11H2,1H3,(H,18,20) |
| InChIKey | APDQZBVWVQGFLN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |