(2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate

C17H19NO4S — CID 46816863

IUPAC(2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate
SMILESCCOc1ccccc1COC(=O)CCNC(=O)c1ccsc1
InChIInChI=1S/C17H19NO4S/c1-2-21-15-6-4-3-5-13(15)11-22-16(19)7-9-18-17(20)14-8-10-23-12-14/h3-6,8,10,12H,2,7,9,11H2,1H3,(H,18,20)
InChIKeyAPDQZBVWVQGFLN-UHFFFAOYSA-N
MW333.41 g/mol
LogP3.01
Rot. Bonds8

About (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate

(2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate (PubChem CID 46816863) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate.

Molecular Properties

Compound Name(2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate
PubChem CID46816863
Molecular FormulaC17H19NO4S
Molecular Weight333.41 g/mol
Exact Mass333.10
IUPAC Name(2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate
SMILESCCOc1ccccc1COC(=O)CCNC(=O)c1ccsc1
InChIInChI=1S/C17H19NO4S/c1-2-21-15-6-4-3-5-13(15)11-22-16(19)7-9-18-17(20)14-8-10-23-12-14/h3-6,8,10,12H,2,7,9,11H2,1H3,(H,18,20)
InChIKeyAPDQZBVWVQGFLN-UHFFFAOYSA-N
XLogP3.01
TPSA64.63 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.41
LogP ≤ 53.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate?
The IUPAC name of (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate (CID 46816863) is (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate.
What is the SMILES notation for (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate?
The canonical SMILES for (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate is CCOc1ccccc1COC(=O)CCNC(=O)c1ccsc1.
What is the InChIKey of (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate?
The InChIKey is APDQZBVWVQGFLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO4S/c1-2-21-15-6-4-3-5-13(15)11-22-16(19)7-9-18-17(20)14-8-10-23-12-14/h3-6,8,10,12H,2,7,9,11H2,1H3,(H,18,20).
What are the key properties of (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate?
(2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate has a molecular weight of 333.41 g/mol, XLogP of 3.01, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxyphenyl)methyl 3-(thiophene-3-carbonylamino)propanoate is sourced from PubChem (CID 46816863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).