C15H14N2O5S — CID 39954497
(4-nitrophenyl)methyl 3-(thiophene-3-carbonylamino)propanoate (PubChem CID 39954497) has the molecular formula C15H14N2O5S and a molecular weight of 334.35 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-(thiophene-3-carbonylamino)propanoate.
| Compound Name | (4-nitrophenyl)methyl 3-(thiophene-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 39954497 |
| Molecular Formula | C15H14N2O5S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (4-nitrophenyl)methyl 3-(thiophene-3-carbonylamino)propanoate |
| SMILES | O=C(CCNC(=O)c1ccsc1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H14N2O5S/c18-14(5-7-16-15(19)12-6-8-23-10-12)22-9-11-1-3-13(4-2-11)17(20)21/h1-4,6,8,10H,5,7,9H2,(H,16,19) |
| InChIKey | RMMQZIZPTZWEMZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|