C11H15NO4S — CID 86913899
2-methoxyethyl 3-(thiophene-3-carbonylamino)propanoate (PubChem CID 86913899) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-methoxyethyl 3-(thiophene-3-carbonylamino)propanoate.
| Compound Name | 2-methoxyethyl 3-(thiophene-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 86913899 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-methoxyethyl 3-(thiophene-3-carbonylamino)propanoate |
| SMILES | COCCOC(=O)CCNC(=O)c1ccsc1 |
| InChI | InChI=1S/C11H15NO4S/c1-15-5-6-16-10(13)2-4-12-11(14)9-3-7-17-8-9/h3,7-8H,2,4-6H2,1H3,(H,12,14) |
| InChIKey | OPAWZSUWGRCHSM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|