C10H16N2OS — CID 62658821
N-[2-(propylamino)ethyl]thiophene-3-carboxamide (PubChem CID 62658821) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is N-[2-(propylamino)ethyl]thiophene-3-carboxamide.
| Compound Name | N-[2-(propylamino)ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 62658821 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N-[2-(propylamino)ethyl]thiophene-3-carboxamide |
| SMILES | CCCNCCNC(=O)c1ccsc1 |
| InChI | InChI=1S/C10H16N2OS/c1-2-4-11-5-6-12-10(13)9-3-7-14-8-9/h3,7-8,11H,2,4-6H2,1H3,(H,12,13) |
| InChIKey | BBUTYNFMDHUHDW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|