C17H18FNO4S — CID 55375350
(3-fluoro-4-methoxyphenyl)methyl 4-(thiophene-3-carbonylamino)butanoate (PubChem CID 55375350) has the molecular formula C17H18FNO4S and a molecular weight of 351.40 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl 4-(thiophene-3-carbonylamino)butanoate.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl 4-(thiophene-3-carbonylamino)butanoate |
|---|---|
| PubChem CID | 55375350 |
| Molecular Formula | C17H18FNO4S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl 4-(thiophene-3-carbonylamino)butanoate |
| SMILES | COc1ccc(COC(=O)CCCNC(=O)c2ccsc2)cc1F |
| InChI | InChI=1S/C17H18FNO4S/c1-22-15-5-4-12(9-14(15)18)10-23-16(20)3-2-7-19-17(21)13-6-8-24-11-13/h4-6,8-9,11H,2-3,7,10H2,1H3,(H,19,21) |
| InChIKey | GXDIUGWHCVGTQL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|