C18H22N2O3S — CID 39958882
N-[4-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 39958882) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is N-[4-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 39958882 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[4-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | COc1ccccc1[C@H](C)NC(=O)CCCNC(=O)c1ccsc1 |
| InChI | InChI=1S/C18H22N2O3S/c1-13(15-6-3-4-7-16(15)23-2)20-17(21)8-5-10-19-18(22)14-9-11-24-12-14/h3-4,6-7,9,11-13H,5,8,10H2,1-2H3,(H,19,22)(H,20,21)/t13-/m0/s1 |
| InChIKey | JXTMEASBWLJQNH-ZDUSSCGKSA-N |
| XLogP | 3.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|