C21H28N2O2S — CID 96530075
N-[4-[[(1R)-2,2-dimethyl-1-(2-methylphenyl)propyl]amino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 96530075) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is N-[4-[[(1R)-2,2-dimethyl-1-(2-methylphenyl)propyl]amino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[[(1R)-2,2-dimethyl-1-(2-methylphenyl)propyl]amino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 96530075 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | N-[4-[[(1R)-2,2-dimethyl-1-(2-methylphenyl)propyl]amino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | Cc1ccccc1[C@H](NC(=O)CCCNC(=O)c1ccsc1)C(C)(C)C |
| InChI | InChI=1S/C21H28N2O2S/c1-15-8-5-6-9-17(15)19(21(2,3)4)23-18(24)10-7-12-22-20(25)16-11-13-26-14-16/h5-6,8-9,11,13-14,19H,7,10,12H2,1-4H3,(H,22,25)(H,23,24)/t19-/m0/s1 |
| InChIKey | DXXKKVANNKQEQG-IBGZPJMESA-N |
| XLogP | 4.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|