C19H22N2O4S — CID 120701095
2-methyl-2-phenyl-3-[4-(thiophene-3-carbonylamino)butanoylamino]propanoic acid (PubChem CID 120701095) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-methyl-2-phenyl-3-[4-(thiophene-3-carbonylamino)butanoylamino]propanoic acid.
| Compound Name | 2-methyl-2-phenyl-3-[4-(thiophene-3-carbonylamino)butanoylamino]propanoic acid |
|---|---|
| PubChem CID | 120701095 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-methyl-2-phenyl-3-[4-(thiophene-3-carbonylamino)butanoylamino]propanoic acid |
| SMILES | CC(CNC(=O)CCCNC(=O)c1ccsc1)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O4S/c1-19(18(24)25,15-6-3-2-4-7-15)13-21-16(22)8-5-10-20-17(23)14-9-11-26-12-14/h2-4,6-7,9,11-12H,5,8,10,13H2,1H3,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | WRNDSHFTNLJUAP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|