C23H24N2O2S — CID 24683991
N-[4-oxo-4-[1-(4-phenylphenyl)ethylamino]butyl]thiophene-3-carboxamide (PubChem CID 24683991) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[4-oxo-4-[1-(4-phenylphenyl)ethylamino]butyl]thiophene-3-carboxamide.
| Compound Name | N-[4-oxo-4-[1-(4-phenylphenyl)ethylamino]butyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 24683991 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[4-oxo-4-[1-(4-phenylphenyl)ethylamino]butyl]thiophene-3-carboxamide |
| SMILES | CC(NC(=O)CCCNC(=O)c1ccsc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-17(18-9-11-20(12-10-18)19-6-3-2-4-7-19)25-22(26)8-5-14-24-23(27)21-13-15-28-16-21/h2-4,6-7,9-13,15-17H,5,8,14H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | MOBMGEZESFNZEB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|