C23H24N2O2S — CID 46432041
N-[3-(1,1-diphenylpropan-2-ylamino)-3-oxopropyl]thiophene-3-carboxamide (PubChem CID 46432041) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[3-(1,1-diphenylpropan-2-ylamino)-3-oxopropyl]thiophene-3-carboxamide.
| Compound Name | N-[3-(1,1-diphenylpropan-2-ylamino)-3-oxopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 46432041 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[3-(1,1-diphenylpropan-2-ylamino)-3-oxopropyl]thiophene-3-carboxamide |
| SMILES | CC(NC(=O)CCNC(=O)c1ccsc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-17(25-21(26)12-14-24-23(27)20-13-15-28-16-20)22(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,13,15-17,22H,12,14H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | OJWLVCNBIFPJIM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |