C30H22Cl2N2O8 — CID 4593726
[2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobutanoate (PubChem CID 4593726) has the molecular formula C30H22Cl2N2O8 and a molecular weight of 609.42 g/mol. Its IUPAC name is [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobutanoate.
| Compound Name | [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4593726 |
| Molecular Formula | C30H22Cl2N2O8 |
| Molecular Weight | 609.42 g/mol |
| Exact Mass | 608.08 |
| IUPAC Name | [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCC(=O)c1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1)Nc1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C30H22Cl2N2O8/c31-20-3-14-28(26(32)17-20)42-25-10-4-21(5-11-25)33-29(36)15-16-30(37)40-18-27(35)19-1-8-23(9-2-19)41-24-12-6-22(7-13-24)34(38)39/h1-14,17H,15-16,18H2,(H,33,36) |
| InChIKey | MXIISMTXQUXLMU-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.42 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|