C49H55N3O2Si — CID 175730276
2-amino-N-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanamide (PubChem CID 175730276) has the molecular formula C49H55N3O2Si and a molecular weight of 746.08 g/mol. Its IUPAC name is 2-amino-N-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanamide.
| Compound Name | 2-amino-N-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanamide |
|---|---|
| PubChem CID | 175730276 |
| Molecular Formula | C49H55N3O2Si |
| Molecular Weight | 746.08 g/mol |
| Exact Mass | 745.41 |
| IUPAC Name | 2-amino-N-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanamide |
| SMILES | Cc1ccc(C(NCCCCC(N)C(=O)Nc2ccc(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C49H55N3O2Si/c1-38-28-32-42(33-29-38)49(40-19-9-5-10-20-40,41-21-11-6-12-22-41)51-36-18-17-27-46(50)47(53)52-43-34-30-39(31-35-43)37-54-55(48(2,3)4,44-23-13-7-14-24-44)45-25-15-8-16-26-45/h5-16,19-26,28-35,46,51H,17-18,27,36-37,50H2,1-4H3,(H,52,53) |
| InChIKey | JUCDJIYHRPCSNS-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.08 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|