C42H44Cl2N4O4 — CID 123690148
(2S)-2-[[(2S)-2-amino-3-(3,4-dichlorophenyl)propanoyl]amino]-N-[4-(hydroxymethyl)phenyl]-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexanamide (PubChem CID 123690148) has the molecular formula C42H44Cl2N4O4 and a molecular weight of 739.74 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-(3,4-dichlorophenyl)propanoyl]amino]-N-[4-(hydroxymethyl)phenyl]-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexanamide.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-(3,4-dichlorophenyl)propanoyl]amino]-N-[4-(hydroxymethyl)phenyl]-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexanamide |
|---|---|
| PubChem CID | 123690148 |
| Molecular Formula | C42H44Cl2N4O4 |
| Molecular Weight | 739.74 g/mol |
| Exact Mass | 738.27 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-(3,4-dichlorophenyl)propanoyl]amino]-N-[4-(hydroxymethyl)phenyl]-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexanamide |
| SMILES | COc1ccc(C(NCCCC[C@H](NC(=O)[C@@H](N)Cc2ccc(Cl)c(Cl)c2)C(=O)Nc2ccc(CO)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H44Cl2N4O4/c1-52-35-22-18-33(19-23-35)42(31-10-4-2-5-11-31,32-12-6-3-7-13-32)46-25-9-8-14-39(41(51)47-34-20-15-29(28-49)16-21-34)48-40(50)38(45)27-30-17-24-36(43)37(44)26-30/h2-7,10-13,15-24,26,38-39,46,49H,8-9,14,25,27-28,45H2,1H3,(H,47,51)(H,48,50)/t38-,39-/m0/s1 |
| InChIKey | XGDVSTPDFFLVSS-YDAXCOIMSA-N |
| XLogP | 7.24 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.74 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|