C42H47N4O3+ — CID 139253450
[1-[[1-[4-(hydroxymethyl)anilino]-6-[[(4-methylphenyl)-diphenylmethyl]amino]-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]azanium (PubChem CID 139253450) has the molecular formula C42H47N4O3+ and a molecular weight of 655.86 g/mol. Its IUPAC name is [1-[[1-[4-(hydroxymethyl)anilino]-6-[[(4-methylphenyl)-diphenylmethyl]amino]-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]azanium.
| Compound Name | [1-[[1-[4-(hydroxymethyl)anilino]-6-[[(4-methylphenyl)-diphenylmethyl]amino]-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 139253450 |
| Molecular Formula | C42H47N4O3+ |
| Molecular Weight | 655.86 g/mol |
| Exact Mass | 655.36 |
| IUPAC Name | [1-[[1-[4-(hydroxymethyl)anilino]-6-[[(4-methylphenyl)-diphenylmethyl]amino]-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]azanium |
| SMILES | Cc1ccc(C(NCCCCC(NC(=O)C([NH3+])Cc2ccccc2)C(=O)Nc2ccc(CO)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H46N4O3/c1-31-20-24-36(25-21-31)42(34-15-7-3-8-16-34,35-17-9-4-10-18-35)44-28-12-11-19-39(41(49)45-37-26-22-33(30-47)23-27-37)46-40(48)38(43)29-32-13-5-2-6-14-32/h2-10,13-18,20-27,38-39,44,47H,11-12,19,28-30,43H2,1H3,(H,45,49)(H,46,48)/p+1 |
| InChIKey | MGTWXHPRRFYSKP-UHFFFAOYSA-O |
| XLogP | 5.52 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.86 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|