C23H33N5O3 — CID 144894754
(2S)-6-amino-2-[(2-amino-3-phenylpropanoyl)amino]-N-[4-(methylaminooxymethyl)phenyl]hexanamide (PubChem CID 144894754) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is (2S)-6-amino-2-[(2-amino-3-phenylpropanoyl)amino]-N-[4-(methylaminooxymethyl)phenyl]hexanamide.
| Compound Name | (2S)-6-amino-2-[(2-amino-3-phenylpropanoyl)amino]-N-[4-(methylaminooxymethyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 144894754 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (2S)-6-amino-2-[(2-amino-3-phenylpropanoyl)amino]-N-[4-(methylaminooxymethyl)phenyl]hexanamide |
| SMILES | CNOCc1ccc(NC(=O)[C@H](CCCCN)NC(=O)C(N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H33N5O3/c1-26-31-16-18-10-12-19(13-11-18)27-23(30)21(9-5-6-14-24)28-22(29)20(25)15-17-7-3-2-4-8-17/h2-4,7-8,10-13,20-21,26H,5-6,9,14-16,24-25H2,1H3,(H,27,30)(H,28,29)/t20?,21-/m0/s1 |
| InChIKey | PCXLAOBPYVSFHQ-LBAQZLPGSA-N |
| XLogP | 1.46 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|