C34H43NO6 — CID 158860179
N-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butyl]-9-hydroxy-4-oxononanamide (PubChem CID 158860179) has the molecular formula C34H43NO6 and a molecular weight of 561.72 g/mol. Its IUPAC name is N-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butyl]-9-hydroxy-4-oxononanamide.
| Compound Name | N-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butyl]-9-hydroxy-4-oxononanamide |
|---|---|
| PubChem CID | 158860179 |
| Molecular Formula | C34H43NO6 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | N-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butyl]-9-hydroxy-4-oxononanamide |
| SMILES | COc1ccc(C(OCCCCNC(=O)CCC(=O)CCCCCO)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H43NO6/c1-39-31-19-14-28(15-20-31)34(27-11-5-3-6-12-27,29-16-21-32(40-2)22-17-29)41-26-10-8-24-35-33(38)23-18-30(37)13-7-4-9-25-36/h3,5-6,11-12,14-17,19-22,36H,4,7-10,13,18,23-26H2,1-2H3,(H,35,38) |
| InChIKey | UHQDEOUWXHAWEM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|