C36H46N2O6 — CID 90223936
pentyl 2-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 90223936) has the molecular formula C36H46N2O6 and a molecular weight of 602.77 g/mol. Its IUPAC name is pentyl 2-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | pentyl 2-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90223936 |
| Molecular Formula | C36H46N2O6 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | pentyl 2-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCCOC(=O)N1CCCC1C(=O)NCCCCOC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C36H46N2O6/c1-4-5-10-26-43-35(40)38-25-12-15-33(38)34(39)37-24-9-11-27-44-36(28-13-7-6-8-14-28,29-16-20-31(41-2)21-17-29)30-18-22-32(42-3)23-19-30/h6-8,13-14,16-23,33H,4-5,9-12,15,24-27H2,1-3H3,(H,37,39) |
| InChIKey | USLRWHDHCNRXSD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|