C59H55N3O9 — CID 167387131
bis(9H-fluoren-9-ylmethyl) 2-[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]carbamoyl]piperazine-1,4-dicarboxylate (PubChem CID 167387131) has the molecular formula C59H55N3O9 and a molecular weight of 950.10 g/mol. Its IUPAC name is bis(9H-fluoren-9-ylmethyl) 2-[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]carbamoyl]piperazine-1,4-dicarboxylate.
| Compound Name | bis(9H-fluoren-9-ylmethyl) 2-[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]carbamoyl]piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 167387131 |
| Molecular Formula | C59H55N3O9 |
| Molecular Weight | 950.10 g/mol |
| Exact Mass | 949.39 |
| IUPAC Name | bis(9H-fluoren-9-ylmethyl) 2-[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]carbamoyl]piperazine-1,4-dicarboxylate |
| SMILES | COc1ccc(C(OCC(O)CNC(=O)C2CN(C(=O)OCC3c4ccccc4-c4ccccc43)CCN2C(=O)OCC2c3ccccc3-c3ccccc32)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C59H55N3O9/c1-67-43-28-24-40(25-29-43)59(39-14-4-3-5-15-39,41-26-30-44(68-2)31-27-41)71-36-42(63)34-60-56(64)55-35-61(57(65)69-37-53-49-20-10-6-16-45(49)46-17-7-11-21-50(46)53)32-33-62(55)58(66)70-38-54-51-22-12-8-18-47(51)48-19-9-13-23-52(48)54/h3-31,42,53-55,63H,32-38H2,1-2H3,(H,60,64) |
| InChIKey | ZNNWZGXXSLDCBF-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.10 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|