C41H38N2O5 — CID 102389959
(2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[[[(4-methoxyphenyl)-diphenylmethyl]amino]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 102389959) has the molecular formula C41H38N2O5 and a molecular weight of 638.76 g/mol. Its IUPAC name is (2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[[[(4-methoxyphenyl)-diphenylmethyl]amino]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[[[(4-methoxyphenyl)-diphenylmethyl]amino]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 102389959 |
| Molecular Formula | C41H38N2O5 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.28 |
| IUPAC Name | (2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[[[(4-methoxyphenyl)-diphenylmethyl]amino]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(C(NC[C@@H]2C[C@@H](C(=O)O)N(C(=O)OCC3c4ccccc4-c4ccccc43)C2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H38N2O5/c1-47-32-22-20-31(21-23-32)41(29-12-4-2-5-13-29,30-14-6-3-7-15-30)42-25-28-24-38(39(44)45)43(26-28)40(46)48-27-37-35-18-10-8-16-33(35)34-17-9-11-19-36(34)37/h2-23,28,37-38,42H,24-27H2,1H3,(H,44,45)/t28-,38-/m0/s1 |
| InChIKey | KMSHWHKAAGYURI-SNFDCCKOSA-N |
| XLogP | 7.30 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|