C42H38N2O5 — CID 102389956
(1S,2S,5R,6R)-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-[[[(4-methoxyphenyl)-diphenylmethyl]amino]methyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (PubChem CID 102389956) has the molecular formula C42H38N2O5 and a molecular weight of 650.78 g/mol. Its IUPAC name is (1S,2S,5R,6R)-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-[[[(4-methoxyphenyl)-diphenylmethyl]amino]methyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid.
| Compound Name | (1S,2S,5R,6R)-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-[[[(4-methoxyphenyl)-diphenylmethyl]amino]methyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
|---|---|
| PubChem CID | 102389956 |
| Molecular Formula | C42H38N2O5 |
| Molecular Weight | 650.78 g/mol |
| Exact Mass | 650.28 |
| IUPAC Name | (1S,2S,5R,6R)-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-[[[(4-methoxyphenyl)-diphenylmethyl]amino]methyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| SMILES | COc1ccc(C(NC[C@@H]2[C@H]3CN[C@@](C(=O)O)(C(=O)OCC4c5ccccc5-c5ccccc54)[C@@H]23)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H38N2O5/c1-48-30-22-20-29(21-23-30)41(27-12-4-2-5-13-27,28-14-6-3-7-15-28)43-24-35-36-25-44-42(38(35)36,39(45)46)40(47)49-26-37-33-18-10-8-16-31(33)32-17-9-11-19-34(32)37/h2-23,35-38,43-44H,24-26H2,1H3,(H,45,46)/t35-,36-,38+,42+/m1/s1 |
| InChIKey | RLTNCRZSLRFXJM-AJDKCWCUSA-N |
| XLogP | 6.22 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.78 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|