C24H25NO6 — CID 69337839
3-tert-butyl-2-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2,4-dicarboxylic acid (PubChem CID 69337839) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-tert-butyl-2-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2,4-dicarboxylic acid.
| Compound Name | 3-tert-butyl-2-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 69337839 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 3-tert-butyl-2-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2,4-dicarboxylic acid |
| SMILES | CC(C)(C)C1C(C(=O)O)NC1(C(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H25NO6/c1-23(2,3)19-18(20(26)27)25-24(19,21(28)29)22(30)31-12-17-15-10-6-4-8-13(15)14-9-5-7-11-16(14)17/h4-11,17-19,25H,12H2,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | AEEYGINZULCNAK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|