C30H25NO4 — CID 68509314
(2S)-3-(9H-fluoren-9-ylmethoxy)-2-methyl-3-oxo-2-(N-phenylanilino)propanoic acid (PubChem CID 68509314) has the molecular formula C30H25NO4 and a molecular weight of 463.53 g/mol. Its IUPAC name is (2S)-3-(9H-fluoren-9-ylmethoxy)-2-methyl-3-oxo-2-(N-phenylanilino)propanoic acid.
| Compound Name | (2S)-3-(9H-fluoren-9-ylmethoxy)-2-methyl-3-oxo-2-(N-phenylanilino)propanoic acid |
|---|---|
| PubChem CID | 68509314 |
| Molecular Formula | C30H25NO4 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (2S)-3-(9H-fluoren-9-ylmethoxy)-2-methyl-3-oxo-2-(N-phenylanilino)propanoic acid |
| SMILES | C[C@](C(=O)O)(C(=O)OCC1c2ccccc2-c2ccccc21)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H25NO4/c1-30(28(32)33,31(21-12-4-2-5-13-21)22-14-6-3-7-15-22)29(34)35-20-27-25-18-10-8-16-23(25)24-17-9-11-19-26(24)27/h2-19,27H,20H2,1H3,(H,32,33)/t30-/m0/s1 |
| InChIKey | HDLUTBVVFAMFCY-PMERELPUSA-N |
| XLogP | 6.02 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|