About 9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate
9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate (PubChem CID 54486413) has the molecular formula C24H25NO2Si
and a molecular weight of 387.56 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate.
Molecular Properties
| Compound Name | 9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate |
| PubChem CID | 54486413 |
| Molecular Formula | C24H25NO2Si |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate |
| SMILES | C[Si](C)(C)N(C(=O)OCC1c2ccccc2-c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C24H25NO2Si/c1-28(2,3)25(18-11-5-4-6-12-18)24(26)27-17-23-21-15-9-7-13-19(21)20-14-8-10-16-22(20)23/h4-16,23H,17H2,1-3H3 |
| InChIKey | XSQBIGQNMFYRJO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate?
The IUPAC name of 9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate (CID 54486413) is 9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate.
What is the SMILES notation for 9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate?
The canonical SMILES for 9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate is C[Si](C)(C)N(C(=O)OCC1c2ccccc2-c2ccccc21)c1ccccc1.
What is the InChIKey of 9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate?
The InChIKey is XSQBIGQNMFYRJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NO2Si/c1-28(2,3)25(18-11-5-4-6-12-18)24(26)27-17-23-21-15-9-7-13-19(21)20-14-8-10-16-22(20)23/h4-16,23H,17H2,1-3H3.
What are the key properties of 9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate?
9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate has a molecular weight of 387.56 g/mol, XLogP of 6.28, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethyl N-phenyl-N-trimethylsilylcarbamate is sourced from PubChem (CID 54486413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).