C18H19NO3 — CID 86810454
9H-fluoren-9-ylmethyl N-hydroxy-N-propylcarbamate (PubChem CID 86810454) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-hydroxy-N-propylcarbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-hydroxy-N-propylcarbamate |
|---|---|
| PubChem CID | 86810454 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-hydroxy-N-propylcarbamate |
| SMILES | CCCN(O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H19NO3/c1-2-11-19(21)18(20)22-12-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,17,21H,2,11-12H2,1H3 |
| InChIKey | VAAHBPMVRXMSHZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|