C40H48Cl2N4O4 — CID 121233598
9H-fluoren-9-ylmethyl N-(3-aminopropyl)-N-[4-[3-aminopropyl(9H-fluoren-9-ylmethoxycarbonyl)amino]butyl]carbamate;dihydrochloride (PubChem CID 121233598) has the molecular formula C40H48Cl2N4O4 and a molecular weight of 719.75 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(3-aminopropyl)-N-[4-[3-aminopropyl(9H-fluoren-9-ylmethoxycarbonyl)amino]butyl]carbamate;dihydrochloride.
| Compound Name | 9H-fluoren-9-ylmethyl N-(3-aminopropyl)-N-[4-[3-aminopropyl(9H-fluoren-9-ylmethoxycarbonyl)amino]butyl]carbamate;dihydrochloride |
|---|---|
| PubChem CID | 121233598 |
| Molecular Formula | C40H48Cl2N4O4 |
| Molecular Weight | 719.75 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(3-aminopropyl)-N-[4-[3-aminopropyl(9H-fluoren-9-ylmethoxycarbonyl)amino]butyl]carbamate;dihydrochloride |
| SMILES | Cl.Cl.NCCCN(CCCCN(CCCN)C(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C40H46N4O4.2ClH/c41-21-11-25-43(39(45)47-27-37-33-17-5-1-13-29(33)30-14-2-6-18-34(30)37)23-9-10-24-44(26-12-22-42)40(46)48-28-38-35-19-7-3-15-31(35)32-16-4-8-20-36(32)38;;/h1-8,13-20,37-38H,9-12,21-28,41-42H2;2*1H |
| InChIKey | QESGHJAMHMBANA-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.75 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|