C20H25N2O5PS — CID 170900524
2-[3-aminopropyl(9H-fluoren-9-ylmethoxycarbonyl)amino]ethylsulfanylphosphonic acid (PubChem CID 170900524) has the molecular formula C20H25N2O5PS and a molecular weight of 436.47 g/mol. Its IUPAC name is 2-[3-aminopropyl(9H-fluoren-9-ylmethoxycarbonyl)amino]ethylsulfanylphosphonic acid.
| Compound Name | 2-[3-aminopropyl(9H-fluoren-9-ylmethoxycarbonyl)amino]ethylsulfanylphosphonic acid |
|---|---|
| PubChem CID | 170900524 |
| Molecular Formula | C20H25N2O5PS |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-[3-aminopropyl(9H-fluoren-9-ylmethoxycarbonyl)amino]ethylsulfanylphosphonic acid |
| SMILES | NCCCN(CCSP(=O)(O)O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H25N2O5PS/c21-10-5-11-22(12-13-29-28(24,25)26)20(23)27-14-19-17-8-3-1-6-15(17)16-7-2-4-9-18(16)19/h1-4,6-9,19H,5,10-14,21H2,(H2,24,25,26) |
| InChIKey | YLLKNIXURDPJJX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|