C38H33NO5S — CID 57363323
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl-[(4-methoxyphenyl)-diphenylmethyl]amino]-3-sulfanylpropanoic acid (PubChem CID 57363323) has the molecular formula C38H33NO5S and a molecular weight of 615.75 g/mol. Its IUPAC name is (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl-[(4-methoxyphenyl)-diphenylmethyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl-[(4-methoxyphenyl)-diphenylmethyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 57363323 |
| Molecular Formula | C38H33NO5S |
| Molecular Weight | 615.75 g/mol |
| Exact Mass | 615.21 |
| IUPAC Name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl-[(4-methoxyphenyl)-diphenylmethyl]amino]-3-sulfanylpropanoic acid |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccccc2)N(C(=O)OCC2c3ccccc3-c3ccccc32)[C@H](CS)C(=O)O)cc1 |
| InChI | InChI=1S/C38H33NO5S/c1-43-29-22-20-28(21-23-29)38(26-12-4-2-5-13-26,27-14-6-3-7-15-27)39(35(25-45)36(40)41)37(42)44-24-34-32-18-10-8-16-30(32)31-17-9-11-19-33(31)34/h2-23,34-35,45H,24-25H2,1H3,(H,40,41)/t35-/m1/s1 |
| InChIKey | PDVNWKGBMMYVQA-PGUFJCEWSA-N |
| XLogP | 7.62 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.75 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|