C39H35NO6 — CID 70150153
2-[[1-benzhydryloxy-1-(4-methoxyphenyl)ethyl]-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid (PubChem CID 70150153) has the molecular formula C39H35NO6 and a molecular weight of 613.71 g/mol. Its IUPAC name is 2-[[1-benzhydryloxy-1-(4-methoxyphenyl)ethyl]-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid.
| Compound Name | 2-[[1-benzhydryloxy-1-(4-methoxyphenyl)ethyl]-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 70150153 |
| Molecular Formula | C39H35NO6 |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 2-[[1-benzhydryloxy-1-(4-methoxyphenyl)ethyl]-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid |
| SMILES | COc1ccc(C(C)(OC(c2ccccc2)c2ccccc2)N(CC(=O)O)C(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C39H35NO6/c1-39(29-21-23-30(44-2)24-22-29,46-37(27-13-5-3-6-14-27)28-15-7-4-8-16-28)40(25-36(41)42)38(43)45-26-35-33-19-11-9-17-31(33)32-18-10-12-20-34(32)35/h3-24,35,37H,25-26H2,1-2H3,(H,41,42) |
| InChIKey | FNNBNTFHQJFMLF-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|