C48H45N3O6 — CID 22976125
9H-fluoren-9-ylmethyl N-[(2S)-1-(2,5-dimethoxyanilino)-5-(methylamino)-1,5-dioxopentan-2-yl]-N-tritylcarbamate (PubChem CID 22976125) has the molecular formula C48H45N3O6 and a molecular weight of 759.90 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-(2,5-dimethoxyanilino)-5-(methylamino)-1,5-dioxopentan-2-yl]-N-tritylcarbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-(2,5-dimethoxyanilino)-5-(methylamino)-1,5-dioxopentan-2-yl]-N-tritylcarbamate |
|---|---|
| PubChem CID | 22976125 |
| Molecular Formula | C48H45N3O6 |
| Molecular Weight | 759.90 g/mol |
| Exact Mass | 759.33 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-(2,5-dimethoxyanilino)-5-(methylamino)-1,5-dioxopentan-2-yl]-N-tritylcarbamate |
| SMILES | CNC(=O)CC[C@@H](C(=O)Nc1cc(OC)ccc1OC)N(C(=O)OCC1c2ccccc2-c2ccccc21)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H45N3O6/c1-49-45(52)30-28-43(46(53)50-42-31-36(55-2)27-29-44(42)56-3)51(47(54)57-32-41-39-25-15-13-23-37(39)38-24-14-16-26-40(38)41)48(33-17-7-4-8-18-33,34-19-9-5-10-20-34)35-21-11-6-12-22-35/h4-27,29,31,41,43H,28,30,32H2,1-3H3,(H,49,52)(H,50,53)/t43-/m0/s1 |
| InChIKey | DFAHPEOVYWGEQL-QLKFWGTOSA-N |
| XLogP | 8.78 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.90 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|