C30H27NO4 — CID 141038963
9H-fluoren-9-ylmethyl 2-amino-2-(2,4-dimethoxyphenyl)-2-phenylacetate (PubChem CID 141038963) has the molecular formula C30H27NO4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2-amino-2-(2,4-dimethoxyphenyl)-2-phenylacetate.
| Compound Name | 9H-fluoren-9-ylmethyl 2-amino-2-(2,4-dimethoxyphenyl)-2-phenylacetate |
|---|---|
| PubChem CID | 141038963 |
| Molecular Formula | C30H27NO4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2-amino-2-(2,4-dimethoxyphenyl)-2-phenylacetate |
| SMILES | COc1ccc(C(N)(C(=O)OCC2c3ccccc3-c3ccccc32)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C30H27NO4/c1-33-21-16-17-27(28(18-21)34-2)30(31,20-10-4-3-5-11-20)29(32)35-19-26-24-14-8-6-12-22(24)23-13-7-9-15-25(23)26/h3-18,26H,19,31H2,1-2H3 |
| InChIKey | XXEHHYKRNBJSKN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |