C23H24O5 — CID 10833633
bis(2,4-dimethoxyphenyl)-phenylmethanol (PubChem CID 10833633) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is bis(2,4-dimethoxyphenyl)-phenylmethanol.
| Compound Name | bis(2,4-dimethoxyphenyl)-phenylmethanol |
|---|---|
| PubChem CID | 10833633 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | bis(2,4-dimethoxyphenyl)-phenylmethanol |
| SMILES | COc1ccc(C(O)(c2ccccc2)c2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C23H24O5/c1-25-17-10-12-19(21(14-17)27-3)23(24,16-8-6-5-7-9-16)20-13-11-18(26-2)15-22(20)28-4/h5-15,24H,1-4H3 |
| InChIKey | NQCUTJZUVUOCGV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|