C23H25NO3 — CID 101076305
(2,4-dimethoxyphenyl)-[4-(dimethylamino)phenyl]-phenylmethanol (PubChem CID 101076305) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-[4-(dimethylamino)phenyl]-phenylmethanol.
| Compound Name | (2,4-dimethoxyphenyl)-[4-(dimethylamino)phenyl]-phenylmethanol |
|---|---|
| PubChem CID | 101076305 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (2,4-dimethoxyphenyl)-[4-(dimethylamino)phenyl]-phenylmethanol |
| SMILES | COc1ccc(C(O)(c2ccccc2)c2ccc(N(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H25NO3/c1-24(2)19-12-10-18(11-13-19)23(25,17-8-6-5-7-9-17)21-15-14-20(26-3)16-22(21)27-4/h5-16,25H,1-4H3 |
| InChIKey | CWRNADBEVCTVFN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|