C27H26O5 — CID 70908135
(3,6-dimethoxynaphthalen-2-yl)-(2,4-dimethoxyphenyl)-phenylmethanol (PubChem CID 70908135) has the molecular formula C27H26O5 and a molecular weight of 430.50 g/mol. Its IUPAC name is (3,6-dimethoxynaphthalen-2-yl)-(2,4-dimethoxyphenyl)-phenylmethanol.
| Compound Name | (3,6-dimethoxynaphthalen-2-yl)-(2,4-dimethoxyphenyl)-phenylmethanol |
|---|---|
| PubChem CID | 70908135 |
| Molecular Formula | C27H26O5 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (3,6-dimethoxynaphthalen-2-yl)-(2,4-dimethoxyphenyl)-phenylmethanol |
| SMILES | COc1ccc(C(O)(c2ccccc2)c2cc3ccc(OC)cc3cc2OC)c(OC)c1 |
| InChI | InChI=1S/C27H26O5/c1-29-21-11-10-18-15-24(25(31-3)16-19(18)14-21)27(28,20-8-6-5-7-9-20)23-13-12-22(30-2)17-26(23)32-4/h5-17,28H,1-4H3 |
| InChIKey | SEPXCVDYMMLXFK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|