C11H16O4 — CID 82713060
2-(2,4-dimethoxyphenyl)propane-1,2-diol (PubChem CID 82713060) has the molecular formula C11H16O4 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)propane-1,2-diol.
| Compound Name | 2-(2,4-dimethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 82713060 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)propane-1,2-diol |
| SMILES | COc1ccc(C(C)(O)CO)c(OC)c1 |
| InChI | InChI=1S/C11H16O4/c1-11(13,7-12)9-5-4-8(14-2)6-10(9)15-3/h4-6,12-13H,7H2,1-3H3 |
| InChIKey | XLLBLFVXBJYZFU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |