About ethyl 3-(2,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate
ethyl 3-(2,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate (PubChem CID 62397793) has the molecular formula C16H24O5
and a molecular weight of 296.36 g/mol. Its IUPAC name is ethyl 3-(2,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate.
Analyze ethyl 3-(2,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate?
The IUPAC name of ethyl 3-(2,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate (CID 62397793) is ethyl 3-(2,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate.
What is the SMILES notation for ethyl 3-(2,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate?
The canonical SMILES for ethyl 3-(2,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate is CCOC(=O)C(C)(C)C(C)(O)c1ccc(OC)cc1OC.
What is the InChIKey of ethyl 3-(2,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate?
The InChIKey is FPQRQCLAJLUHOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O5/c1-7-21-14(17)15(2,3)16(4,18)12-9-8-11(19-5)10-13(12)20-6/h8-10,18H,7H2,1-6H3.
What are the key properties of ethyl 3-(2,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate?
ethyl 3-(2,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate has a molecular weight of 296.36 g/mol, XLogP of 2.50, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate is sourced from PubChem (CID 62397793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).