C16H24O4 — CID 62399004
ethyl 3-(2-ethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate (PubChem CID 62399004) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is ethyl 3-(2-ethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate.
| Compound Name | ethyl 3-(2-ethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 62399004 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | ethyl 3-(2-ethoxyphenyl)-3-hydroxy-2,2-dimethylbutanoate |
| SMILES | CCOC(=O)C(C)(C)C(C)(O)c1ccccc1OCC |
| InChI | InChI=1S/C16H24O4/c1-6-19-13-11-9-8-10-12(13)16(5,18)15(3,4)14(17)20-7-2/h8-11,18H,6-7H2,1-5H3 |
| InChIKey | WXWJNNLBFWTWQH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |