C14H18F2O4 — CID 62397772
ethyl 3-(2-ethoxyphenyl)-2,2-difluoro-3-hydroxybutanoate (PubChem CID 62397772) has the molecular formula C14H18F2O4 and a molecular weight of 288.29 g/mol. Its IUPAC name is ethyl 3-(2-ethoxyphenyl)-2,2-difluoro-3-hydroxybutanoate.
| Compound Name | ethyl 3-(2-ethoxyphenyl)-2,2-difluoro-3-hydroxybutanoate |
|---|---|
| PubChem CID | 62397772 |
| Molecular Formula | C14H18F2O4 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | ethyl 3-(2-ethoxyphenyl)-2,2-difluoro-3-hydroxybutanoate |
| SMILES | CCOC(=O)C(F)(F)C(C)(O)c1ccccc1OCC |
| InChI | InChI=1S/C14H18F2O4/c1-4-19-11-9-7-6-8-10(11)13(3,18)14(15,16)12(17)20-5-2/h6-9,18H,4-5H2,1-3H3 |
| InChIKey | OCPAWOWBLQMDEG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |