C15H22O5 — CID 66322325
ethyl 4-(2,4-dimethoxyphenyl)-4-hydroxypentanoate (PubChem CID 66322325) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is ethyl 4-(2,4-dimethoxyphenyl)-4-hydroxypentanoate.
| Compound Name | ethyl 4-(2,4-dimethoxyphenyl)-4-hydroxypentanoate |
|---|---|
| PubChem CID | 66322325 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | ethyl 4-(2,4-dimethoxyphenyl)-4-hydroxypentanoate |
| SMILES | CCOC(=O)CCC(C)(O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C15H22O5/c1-5-20-14(16)8-9-15(2,17)12-7-6-11(18-3)10-13(12)19-4/h6-7,10,17H,5,8-9H2,1-4H3 |
| InChIKey | VTZYIWOBUMHJIW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |